C19H21N3O3S — CID 16918046
1-[2-(1,2-dimethylindol-3-yl)sulfonylethyl]-3-phenylurea (PubChem CID 16918046) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[2-(1,2-dimethylindol-3-yl)sulfonylethyl]-3-phenylurea.
| Compound Name | 1-[2-(1,2-dimethylindol-3-yl)sulfonylethyl]-3-phenylurea |
|---|---|
| PubChem CID | 16918046 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[2-(1,2-dimethylindol-3-yl)sulfonylethyl]-3-phenylurea |
| SMILES | Cc1c(S(=O)(=O)CCNC(=O)Nc2ccccc2)c2ccccc2n1C |
| InChI | InChI=1S/C19H21N3O3S/c1-14-18(16-10-6-7-11-17(16)22(14)2)26(24,25)13-12-20-19(23)21-15-8-4-3-5-9-15/h3-11H,12-13H2,1-2H3,(H2,20,21,23) |
| InChIKey | OHDSFOPFXGTSRN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |