C25H23F2N3O3S — CID 16918115
1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(2,6-difluorophenyl)urea (PubChem CID 16918115) has the molecular formula C25H23F2N3O3S and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 16918115 |
| Molecular Formula | C25H23F2N3O3S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(2,6-difluorophenyl)urea |
| SMILES | Cc1c(S(=O)(=O)CCNC(=O)Nc2c(F)cccc2F)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C25H23F2N3O3S/c1-17-24(19-10-5-6-13-22(19)30(17)16-18-8-3-2-4-9-18)34(32,33)15-14-28-25(31)29-23-20(26)11-7-12-21(23)27/h2-13H,14-16H2,1H3,(H2,28,29,31) |
| InChIKey | CWXFIEMFMRUWPM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |