C31H37N3O6S — CID 43955416
1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 43955416) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 43955416 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)NCCS(=O)(=O)c2c(C)n(Cc3ccccc3)c3ccccc23)cc(OCC)c1OCC |
| InChI | InChI=1S/C31H37N3O6S/c1-5-38-27-19-24(20-28(39-6-2)29(27)40-7-3)33-31(35)32-17-18-41(36,37)30-22(4)34(21-23-13-9-8-10-14-23)26-16-12-11-15-25(26)30/h8-16,19-20H,5-7,17-18,21H2,1-4H3,(H2,32,33,35) |
| InChIKey | PRCUMENWWKMYSO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |