C21H27ClN2O4 — CID 108869954
1-[2-(4-chlorophenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869954) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869954 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)NCCc2ccc(Cl)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H27ClN2O4/c1-4-26-18-13-17(14-19(27-5-2)20(18)28-6-3)24-21(25)23-12-11-15-7-9-16(22)10-8-15/h7-10,13-14H,4-6,11-12H2,1-3H3,(H2,23,24,25) |
| InChIKey | OQZJHDNVINUUBW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |