C27H29N3O3S — CID 16918119
1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,5-dimethylphenyl)urea (PubChem CID 16918119) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 16918119 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 1-[2-(1-benzyl-2-methylindol-3-yl)sulfonylethyl]-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCCS(=O)(=O)c2c(C)n(Cc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-19-15-20(2)17-23(16-19)29-27(31)28-13-14-34(32,33)26-21(3)30(18-22-9-5-4-6-10-22)25-12-8-7-11-24(25)26/h4-12,15-17H,13-14,18H2,1-3H3,(H2,28,29,31) |
| InChIKey | ZAGGOIVZVBBXCE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |