C15H16N2O6S — CID 68818458
2-[(4-aminonaphthalen-1-yl)sulfonylamino]pentanedioic acid (PubChem CID 68818458) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-[(4-aminonaphthalen-1-yl)sulfonylamino]pentanedioic acid.
| Compound Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 68818458 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[(4-aminonaphthalen-1-yl)sulfonylamino]pentanedioic acid |
| SMILES | Nc1ccc(S(=O)(=O)NC(CCC(=O)O)C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C15H16N2O6S/c16-11-5-7-13(10-4-2-1-3-9(10)11)24(22,23)17-12(15(20)21)6-8-14(18)19/h1-5,7,12,17H,6,8,16H2,(H,18,19)(H,20,21) |
| InChIKey | XKJQIEKXGZPYDY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|