C12H12N2O6S — CID 61143430
(2S)-2-[(2-cyanophenyl)sulfonylamino]pentanedioic acid (PubChem CID 61143430) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is (2S)-2-[(2-cyanophenyl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-cyanophenyl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61143430 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2S)-2-[(2-cyanophenyl)sulfonylamino]pentanedioic acid |
| SMILES | N#Cc1ccccc1S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H12N2O6S/c13-7-8-3-1-2-4-10(8)21(19,20)14-9(12(17)18)5-6-11(15)16/h1-4,9,14H,5-6H2,(H,15,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | HUJQACWBHITMEE-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |