C12H12F2N2O2S — CID 112594590
4-amino-N-(2,2-difluoroethyl)naphthalene-1-sulfonamide (PubChem CID 112594590) has the molecular formula C12H12F2N2O2S and a molecular weight of 286.30 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoroethyl)naphthalene-1-sulfonamide.
| Compound Name | 4-amino-N-(2,2-difluoroethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 112594590 |
| Molecular Formula | C12H12F2N2O2S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-amino-N-(2,2-difluoroethyl)naphthalene-1-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC(F)F)c2ccccc12 |
| InChI | InChI=1S/C12H12F2N2O2S/c13-12(14)7-16-19(17,18)11-6-5-10(15)8-3-1-2-4-9(8)11/h1-6,12,16H,7,15H2 |
| InChIKey | IXRBNQMLNCMRHX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|