C23H24N4O4S2 — CID 87624232
1,1-bis[(4-aminonaphthalen-1-yl)sulfonyl]propane-1,3-diamine (PubChem CID 87624232) has the molecular formula C23H24N4O4S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1,1-bis[(4-aminonaphthalen-1-yl)sulfonyl]propane-1,3-diamine.
| Compound Name | 1,1-bis[(4-aminonaphthalen-1-yl)sulfonyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 87624232 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1,1-bis[(4-aminonaphthalen-1-yl)sulfonyl]propane-1,3-diamine |
| SMILES | NCCC(N)(S(=O)(=O)c1ccc(N)c2ccccc12)S(=O)(=O)c1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C23H24N4O4S2/c24-14-13-23(27,32(28,29)21-11-9-19(25)15-5-1-3-7-17(15)21)33(30,31)22-12-10-20(26)16-6-2-4-8-18(16)22/h1-12H,13-14,24-27H2 |
| InChIKey | SCHOAMMIWQWOGH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|