C16H15N3O4S — CID 67954921
4-amino-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 67954921) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-amino-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | 4-amino-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 67954921 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-amino-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCCN2C(=O)C=CC2=O)c2ccccc12 |
| InChI | InChI=1S/C16H15N3O4S/c17-13-5-6-14(12-4-2-1-3-11(12)13)24(22,23)18-9-10-19-15(20)7-8-16(19)21/h1-8,18H,9-10,17H2 |
| InChIKey | YPAUWMKHEMCYJG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|