C17H25N3O2S — CID 140980037
1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpentane-1,1-diamine (PubChem CID 140980037) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpentane-1,1-diamine.
| Compound Name | 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpentane-1,1-diamine |
|---|---|
| PubChem CID | 140980037 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpentane-1,1-diamine |
| SMILES | CCCCC(N)(N)S(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C17H25N3O2S/c1-4-5-12-17(18,19)23(21,22)16-11-7-8-13-14(16)9-6-10-15(13)20(2)3/h6-11H,4-5,12,18-19H2,1-3H3 |
| InChIKey | KDVJYDPRVAZRTE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|