C19H25N3O4S — CID 66997930
ethyl (3S,4R)-4-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-methylpiperidine-1-carboxylate (PubChem CID 66997930) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is ethyl (3S,4R)-4-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-methylpiperidine-1-carboxylate.
| Compound Name | ethyl (3S,4R)-4-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 66997930 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl (3S,4R)-4-[(4-aminonaphthalen-1-yl)sulfonylamino]-3-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](NS(=O)(=O)c2ccc(N)c3ccccc23)[C@@H](C)C1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-26-19(23)22-11-10-17(13(2)12-22)21-27(24,25)18-9-8-16(20)14-6-4-5-7-15(14)18/h4-9,13,17,21H,3,10-12,20H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | FEGCKYWVCIHASS-SUMWQHHRSA-N |
| XLogP | 2.57 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|