C9H17ClN2O2 — CID 89048402
ethyl (3S,4R)-4-(chloroamino)-3-methylpiperidine-1-carboxylate (PubChem CID 89048402) has the molecular formula C9H17ClN2O2 and a molecular weight of 220.70 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(chloroamino)-3-methylpiperidine-1-carboxylate.
| Compound Name | ethyl (3S,4R)-4-(chloroamino)-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89048402 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | ethyl (3S,4R)-4-(chloroamino)-3-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H](NCl)[C@@H](C)C1 |
| InChI | InChI=1S/C9H17ClN2O2/c1-3-14-9(13)12-5-4-8(11-10)7(2)6-12/h7-8,11H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | NJNHPIBQFCNGBP-JGVFFNPUSA-N |
| XLogP | 1.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|