C27H27N3O6S — CID 66998248
ethyl 4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 66998248) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is ethyl 4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66998248 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | ethyl 4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C27H27N3O6S/c1-2-36-27(33)29-15-13-19(14-16-29)28-37(34,35)24-12-11-18(20-7-3-4-8-21(20)24)17-30-25(31)22-9-5-6-10-23(22)26(30)32/h3-12,19,28H,2,13-17H2,1H3 |
| InChIKey | AUWLVWSCNOEWHS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|