C25H26ClN3O5S — CID 87230277
ethyl 4-[[5-[chloro(phenyl)carbamoyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 87230277) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is ethyl 4-[[5-[chloro(phenyl)carbamoyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-[chloro(phenyl)carbamoyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87230277 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | ethyl 4-[[5-[chloro(phenyl)carbamoyl]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2cccc3c(C(=O)N(Cl)c4ccccc4)cccc23)CC1 |
| InChI | InChI=1S/C25H26ClN3O5S/c1-2-34-25(31)28-16-14-18(15-17-28)27-35(32,33)23-13-7-10-20-21(23)11-6-12-22(20)24(30)29(26)19-8-4-3-5-9-19/h3-13,18,27H,2,14-17H2,1H3 |
| InChIKey | NPUIYRAQLWLWSN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|