C26H26N4O5S — CID 59656408
ethyl 4-[[4-[(2-cyanobenzoyl)amino]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 59656408) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is ethyl 4-[[4-[(2-cyanobenzoyl)amino]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[(2-cyanobenzoyl)amino]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59656408 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | ethyl 4-[[4-[(2-cyanobenzoyl)amino]naphthalen-1-yl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C#N)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H26N4O5S/c1-2-35-26(32)30-15-13-19(14-16-30)29-36(33,34)24-12-11-23(21-9-5-6-10-22(21)24)28-25(31)20-8-4-3-7-18(20)17-27/h3-12,19,29H,2,13-16H2,1H3,(H,28,31) |
| InChIKey | YRQAOFAJCXFKDN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |