C28H33N5O3S — CID 59656510
2-methyl-N-[4-[[1-(pyrrolidine-1-carboximidoyl)piperidin-4-yl]sulfamoyl]naphthalen-1-yl]benzamide (PubChem CID 59656510) has the molecular formula C28H33N5O3S and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-methyl-N-[4-[[1-(pyrrolidine-1-carboximidoyl)piperidin-4-yl]sulfamoyl]naphthalen-1-yl]benzamide.
| Compound Name | 2-methyl-N-[4-[[1-(pyrrolidine-1-carboximidoyl)piperidin-4-yl]sulfamoyl]naphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 59656510 |
| Molecular Formula | C28H33N5O3S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-methyl-N-[4-[[1-(pyrrolidine-1-carboximidoyl)piperidin-4-yl]sulfamoyl]naphthalen-1-yl]benzamide |
| SMILES | [H]/N=C(\N1CCCC1)N1CCC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H33N5O3S/c1-20-8-2-3-9-22(20)27(34)30-25-12-13-26(24-11-5-4-10-23(24)25)37(35,36)31-21-14-18-33(19-15-21)28(29)32-16-6-7-17-32/h2-5,8-13,21,29,31H,6-7,14-19H2,1H3,(H,30,34)/b29-28+ |
| InChIKey | FNKUTUVRISHVTC-ZQHSETAFSA-N |
| XLogP | 4.17 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|