C20H24N2O5S — CID 69009615
5-[(1-butanoylpiperidin-4-yl)sulfamoyl]naphthalene-1-carboxylic acid (PubChem CID 69009615) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-[(1-butanoylpiperidin-4-yl)sulfamoyl]naphthalene-1-carboxylic acid.
| Compound Name | 5-[(1-butanoylpiperidin-4-yl)sulfamoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 69009615 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-[(1-butanoylpiperidin-4-yl)sulfamoyl]naphthalene-1-carboxylic acid |
| SMILES | CCCC(=O)N1CCC(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)CC1 |
| InChI | InChI=1S/C20H24N2O5S/c1-2-5-19(23)22-12-10-14(11-13-22)21-28(26,27)18-9-4-6-15-16(18)7-3-8-17(15)20(24)25/h3-4,6-9,14,21H,2,5,10-13H2,1H3,(H,24,25) |
| InChIKey | CJAISATZUOIIPV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |