C25H24N4O5S — CID 122390547
4-[[5-(1,3-dioxoisoindol-2-yl)naphthalen-1-yl]sulfonylamino]-N-methylpiperidine-1-carboxamide (PubChem CID 122390547) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-[[5-(1,3-dioxoisoindol-2-yl)naphthalen-1-yl]sulfonylamino]-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[[5-(1,3-dioxoisoindol-2-yl)naphthalen-1-yl]sulfonylamino]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 122390547 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4-[[5-(1,3-dioxoisoindol-2-yl)naphthalen-1-yl]sulfonylamino]-N-methylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(NS(=O)(=O)c2cccc3c(N4C(=O)c5ccccc5C4=O)cccc23)CC1 |
| InChI | InChI=1S/C25H24N4O5S/c1-26-25(32)28-14-12-16(13-15-28)27-35(33,34)22-11-5-8-17-18(22)9-4-10-21(17)29-23(30)19-6-2-3-7-20(19)24(29)31/h2-11,16,27H,12-15H2,1H3,(H,26,32) |
| InChIKey | SZPXDYMJQGIIHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|