C19H26N2O3 — CID 11078039
4-[(2-methylpropan-2-yl)oxy]butyl N-(5-aminonaphthalen-1-yl)carbamate (PubChem CID 11078039) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]butyl N-(5-aminonaphthalen-1-yl)carbamate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]butyl N-(5-aminonaphthalen-1-yl)carbamate |
|---|---|
| PubChem CID | 11078039 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]butyl N-(5-aminonaphthalen-1-yl)carbamate |
| SMILES | CC(C)(C)OCCCCOC(=O)Nc1cccc2c(N)cccc12 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)24-13-5-4-12-23-18(22)21-17-11-7-8-14-15(17)9-6-10-16(14)20/h6-11H,4-5,12-13,20H2,1-3H3,(H,21,22) |
| InChIKey | GEHWEIRENFCCFR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|