C22H30N2O6 — CID 86204036
4-methoxybutyl N-[5-(4-methoxybutoxycarbonylamino)naphthalen-1-yl]carbamate (PubChem CID 86204036) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-methoxybutyl N-[5-(4-methoxybutoxycarbonylamino)naphthalen-1-yl]carbamate.
| Compound Name | 4-methoxybutyl N-[5-(4-methoxybutoxycarbonylamino)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 86204036 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-methoxybutyl N-[5-(4-methoxybutoxycarbonylamino)naphthalen-1-yl]carbamate |
| SMILES | COCCCCOC(=O)Nc1cccc2c(NC(=O)OCCCCOC)cccc12 |
| InChI | InChI=1S/C22H30N2O6/c1-27-13-3-5-15-29-21(25)23-19-11-7-10-18-17(19)9-8-12-20(18)24-22(26)30-16-6-4-14-28-2/h7-12H,3-6,13-16H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZAZJNTAAERIBIT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|