C27H33N3O7S — CID 142040330
2-(2-methoxyethoxy)ethyl N-[5-[[4-(2,2-dimethylpropanoylamino)phenyl]sulfamoyl]naphthalen-1-yl]carbamate (PubChem CID 142040330) has the molecular formula C27H33N3O7S and a molecular weight of 543.64 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[5-[[4-(2,2-dimethylpropanoylamino)phenyl]sulfamoyl]naphthalen-1-yl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[5-[[4-(2,2-dimethylpropanoylamino)phenyl]sulfamoyl]naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 142040330 |
| Molecular Formula | C27H33N3O7S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[5-[[4-(2,2-dimethylpropanoylamino)phenyl]sulfamoyl]naphthalen-1-yl]carbamate |
| SMILES | COCCOCCOC(=O)Nc1cccc2c(S(=O)(=O)Nc3ccc(NC(=O)C(C)(C)C)cc3)cccc12 |
| InChI | InChI=1S/C27H33N3O7S/c1-27(2,3)25(31)28-19-11-13-20(14-12-19)30-38(33,34)24-10-6-7-21-22(24)8-5-9-23(21)29-26(32)37-18-17-36-16-15-35-4/h5-14,30H,15-18H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | PYNPZYPZTJAEOI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|