C22H21ClN2O5S — CID 11155424
5-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]naphthalene-1-carboxylic acid (PubChem CID 11155424) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is 5-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]naphthalene-1-carboxylic acid.
| Compound Name | 5-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11155424 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 5-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]naphthalene-1-carboxylic acid |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(NS(=O)(=O)c2cccc3c(C(=O)O)cccc23)cc1 |
| InChI | InChI=1S/C22H21ClN2O5S/c1-22(2,13-23)21(28)24-14-9-11-15(12-10-14)25-31(29,30)19-8-4-5-16-17(19)6-3-7-18(16)20(26)27/h3-12,25H,13H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | MFQHGNFXKTUCGR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|