C35H35N3O3S — CID 59900306
N-[4-[[5-(dibenzylamino)naphthalen-1-yl]sulfonylamino]phenyl]-2,2-dimethylpropanamide (PubChem CID 59900306) has the molecular formula C35H35N3O3S and a molecular weight of 577.75 g/mol. Its IUPAC name is N-[4-[[5-(dibenzylamino)naphthalen-1-yl]sulfonylamino]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[5-(dibenzylamino)naphthalen-1-yl]sulfonylamino]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 59900306 |
| Molecular Formula | C35H35N3O3S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | N-[4-[[5-(dibenzylamino)naphthalen-1-yl]sulfonylamino]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(NS(=O)(=O)c2cccc3c(N(Cc4ccccc4)Cc4ccccc4)cccc23)cc1 |
| InChI | InChI=1S/C35H35N3O3S/c1-35(2,3)34(39)36-28-20-22-29(23-21-28)37-42(40,41)33-19-11-16-30-31(33)17-10-18-32(30)38(24-26-12-6-4-7-13-26)25-27-14-8-5-9-15-27/h4-23,37H,24-25H2,1-3H3,(H,36,39) |
| InChIKey | SAVFQRHTSFAFOT-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |