C31H34ClN5O5S2 — CID 142026367
2-amino-N-[4-[[5-(4-benzylpiperazin-1-yl)sulfonylnaphthalen-1-yl]sulfonylamino]phenyl]-3-chloro-2-methylpropanamide (PubChem CID 142026367) has the molecular formula C31H34ClN5O5S2 and a molecular weight of 656.23 g/mol. Its IUPAC name is 2-amino-N-[4-[[5-(4-benzylpiperazin-1-yl)sulfonylnaphthalen-1-yl]sulfonylamino]phenyl]-3-chloro-2-methylpropanamide.
| Compound Name | 2-amino-N-[4-[[5-(4-benzylpiperazin-1-yl)sulfonylnaphthalen-1-yl]sulfonylamino]phenyl]-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 142026367 |
| Molecular Formula | C31H34ClN5O5S2 |
| Molecular Weight | 656.23 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 2-amino-N-[4-[[5-(4-benzylpiperazin-1-yl)sulfonylnaphthalen-1-yl]sulfonylamino]phenyl]-3-chloro-2-methylpropanamide |
| SMILES | CC(N)(CCl)C(=O)Nc1ccc(NS(=O)(=O)c2cccc3c(S(=O)(=O)N4CCN(Cc5ccccc5)CC4)cccc23)cc1 |
| InChI | InChI=1S/C31H34ClN5O5S2/c1-31(33,22-32)30(38)34-24-13-15-25(16-14-24)35-43(39,40)28-11-5-10-27-26(28)9-6-12-29(27)44(41,42)37-19-17-36(18-20-37)21-23-7-3-2-4-8-23/h2-16,35H,17-22,33H2,1H3,(H,34,38) |
| InChIKey | WSNDYIXIHNRLOH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|