C22H27ClN4O5S — CID 142036869
N-[2-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]phenyl]morpholine-4-carboxamide (PubChem CID 142036869) has the molecular formula C22H27ClN4O5S and a molecular weight of 495.00 g/mol. Its IUPAC name is N-[2-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 142036869 |
| Molecular Formula | C22H27ClN4O5S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[2-[[4-[(3-chloro-2,2-dimethylpropanoyl)amino]phenyl]sulfamoyl]phenyl]morpholine-4-carboxamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(NS(=O)(=O)c2ccccc2NC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27ClN4O5S/c1-22(2,15-23)20(28)24-16-7-9-17(10-8-16)26-33(30,31)19-6-4-3-5-18(19)25-21(29)27-11-13-32-14-12-27/h3-10,26H,11-15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | UNTWZFUQYCYFDM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|