C24H21N3O4S — CID 59656517
1-[4-[(4-methoxyphenyl)sulfamoyl]naphthalen-1-yl]-3-phenylurea (PubChem CID 59656517) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-[4-[(4-methoxyphenyl)sulfamoyl]naphthalen-1-yl]-3-phenylurea.
| Compound Name | 1-[4-[(4-methoxyphenyl)sulfamoyl]naphthalen-1-yl]-3-phenylurea |
|---|---|
| PubChem CID | 59656517 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-[4-[(4-methoxyphenyl)sulfamoyl]naphthalen-1-yl]-3-phenylurea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-31-19-13-11-18(12-14-19)27-32(29,30)23-16-15-22(20-9-5-6-10-21(20)23)26-24(28)25-17-7-3-2-4-8-17/h2-16,27H,1H3,(H2,25,26,28) |
| InChIKey | QWEFATNJPIYJCY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |