C31H36Cl2N2O4 — CID 157060860
tert-butyl N-[4-(3-chloropropoxy)naphthalen-1-yl]carbamate;4-(3-chloropropoxy)naphthalen-1-amine (PubChem CID 157060860) has the molecular formula C31H36Cl2N2O4 and a molecular weight of 571.55 g/mol. Its IUPAC name is tert-butyl N-[4-(3-chloropropoxy)naphthalen-1-yl]carbamate;4-(3-chloropropoxy)naphthalen-1-amine.
| Compound Name | tert-butyl N-[4-(3-chloropropoxy)naphthalen-1-yl]carbamate;4-(3-chloropropoxy)naphthalen-1-amine |
|---|---|
| PubChem CID | 157060860 |
| Molecular Formula | C31H36Cl2N2O4 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | tert-butyl N-[4-(3-chloropropoxy)naphthalen-1-yl]carbamate;4-(3-chloropropoxy)naphthalen-1-amine |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OCCCCl)c2ccccc12.Nc1ccc(OCCCCl)c2ccccc12 |
| InChI | InChI=1S/C18H22ClNO3.C13H14ClNO/c1-18(2,3)23-17(21)20-15-9-10-16(22-12-6-11-19)14-8-5-4-7-13(14)15;14-8-3-9-16-13-7-6-12(15)10-4-1-2-5-11(10)13/h4-5,7-10H,6,11-12H2,1-3H3,(H,20,21);1-2,4-7H,3,8-9,15H2 |
| InChIKey | ABHWEPOIPHZRGH-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|