C19H18ClN3O3 — CID 86711521
tert-butyl N-[4-(6-chloropyrimidin-4-yl)oxynaphthalen-1-yl]carbamate (PubChem CID 86711521) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is tert-butyl N-[4-(6-chloropyrimidin-4-yl)oxynaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-(6-chloropyrimidin-4-yl)oxynaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 86711521 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | tert-butyl N-[4-(6-chloropyrimidin-4-yl)oxynaphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2cc(Cl)ncn2)c2ccccc12 |
| InChI | InChI=1S/C19H18ClN3O3/c1-19(2,3)26-18(24)23-14-8-9-15(13-7-5-4-6-12(13)14)25-17-10-16(20)21-11-22-17/h4-11H,1-3H3,(H,23,24) |
| InChIKey | NGNVJGDCQIPYJU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |