C20H19N5O4 — CID 140610210
tert-butyl N-[4-[(8-oxo-7,9-dihydropurin-6-yl)oxy]naphthalen-1-yl]carbamate (PubChem CID 140610210) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is tert-butyl N-[4-[(8-oxo-7,9-dihydropurin-6-yl)oxy]naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(8-oxo-7,9-dihydropurin-6-yl)oxy]naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 140610210 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | tert-butyl N-[4-[(8-oxo-7,9-dihydropurin-6-yl)oxy]naphthalen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ncnc3[nH]c(=O)[nH]c23)c2ccccc12 |
| InChI | InChI=1S/C20H19N5O4/c1-20(2,3)29-19(27)23-13-8-9-14(12-7-5-4-6-11(12)13)28-17-15-16(21-10-22-17)25-18(26)24-15/h4-10H,1-3H3,(H,23,27)(H2,21,22,24,25,26) |
| InChIKey | GIIZSCUGKVBZKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |