C20H22ClN3O3 — CID 59380902
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(2-chloroethoxy)naphthalen-1-yl]urea (PubChem CID 59380902) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(2-chloroethoxy)naphthalen-1-yl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(2-chloroethoxy)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 59380902 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(2-chloroethoxy)naphthalen-1-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(OCCCl)c3ccccc23)no1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-20(2,3)17-12-18(24-27-17)23-19(25)22-15-8-9-16(26-11-10-21)14-7-5-4-6-13(14)15/h4-9,12H,10-11H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | PWYBJHLCRBAULM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|