C17H23N3O2 — CID 108812450
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-(2-methylphenyl)ethyl]urea (PubChem CID 108812450) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-(2-methylphenyl)ethyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108812450 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[2-(2-methylphenyl)ethyl]urea |
| SMILES | Cc1ccccc1CCNC(=O)Nc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C17H23N3O2/c1-12-7-5-6-8-13(12)9-10-18-16(21)19-15-11-14(22-20-15)17(2,3)4/h5-8,11H,9-10H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | RVYDFSHDEIKHAY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |