C14H17NO3 — CID 117370501
ethyl 2-(2,3-dimethyl-1H-indol-7-yl)-2-hydroxyacetate (PubChem CID 117370501) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 2-(2,3-dimethyl-1H-indol-7-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(2,3-dimethyl-1H-indol-7-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117370501 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 2-(2,3-dimethyl-1H-indol-7-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cccc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C14H17NO3/c1-4-18-14(17)13(16)11-7-5-6-10-8(2)9(3)15-12(10)11/h5-7,13,15-16H,4H2,1-3H3 |
| InChIKey | XUMGDJZYUZSKIO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|