C12H16O5 — CID 117352981
ethyl 2-[2-(1,2-dihydroxyethyl)phenyl]-2-hydroxyacetate (PubChem CID 117352981) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 2-[2-(1,2-dihydroxyethyl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[2-(1,2-dihydroxyethyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117352981 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 2-[2-(1,2-dihydroxyethyl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccccc1C(O)CO |
| InChI | InChI=1S/C12H16O5/c1-2-17-12(16)11(15)9-6-4-3-5-8(9)10(14)7-13/h3-6,10-11,13-15H,2,7H2,1H3 |
| InChIKey | MHPWCROAEDQALV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |