C17H20N4O2 — CID 8812284
ethyl (E)-3-[(2-tert-butyl-3H-benzimidazol-5-yl)amino]-2-cyanoprop-2-enoate (PubChem CID 8812284) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl (E)-3-[(2-tert-butyl-3H-benzimidazol-5-yl)amino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2-tert-butyl-3H-benzimidazol-5-yl)amino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 8812284 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl (E)-3-[(2-tert-butyl-3H-benzimidazol-5-yl)amino]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccc2nc(C(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C17H20N4O2/c1-5-23-15(22)11(9-18)10-19-12-6-7-13-14(8-12)21-16(20-13)17(2,3)4/h6-8,10,19H,5H2,1-4H3,(H,20,21)/b11-10+ |
| InChIKey | OTSZTGLCAYLMJW-ZHACJKMWSA-N |
| XLogP | 3.24 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|