C13H14O4 — CID 90255816
3,4-diethoxychromen-2-one (PubChem CID 90255816) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3,4-diethoxychromen-2-one.
| Compound Name | 3,4-diethoxychromen-2-one |
|---|---|
| PubChem CID | 90255816 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,4-diethoxychromen-2-one |
| SMILES | CCOc1c(OCC)c2ccccc2oc1=O |
| InChI | InChI=1S/C13H14O4/c1-3-15-11-9-7-5-6-8-10(9)17-13(14)12(11)16-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | DXDRABCBYTXSBZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|