C19H20N4O4 — CID 11760364
ethyl (E)-3-[[(5E)-5-hydrazinylidene-2-oxo-7,8-dihydro-6H-chromen-3-yl]amino]-2-pyridin-2-ylprop-2-enoate (PubChem CID 11760364) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl (E)-3-[[(5E)-5-hydrazinylidene-2-oxo-7,8-dihydro-6H-chromen-3-yl]amino]-2-pyridin-2-ylprop-2-enoate.
| Compound Name | ethyl (E)-3-[[(5E)-5-hydrazinylidene-2-oxo-7,8-dihydro-6H-chromen-3-yl]amino]-2-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 11760364 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl (E)-3-[[(5E)-5-hydrazinylidene-2-oxo-7,8-dihydro-6H-chromen-3-yl]amino]-2-pyridin-2-ylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/Nc1cc2c(oc1=O)CCC/C2=N\N)c1ccccn1 |
| InChI | InChI=1S/C19H20N4O4/c1-2-26-18(24)13(14-6-3-4-9-21-14)11-22-16-10-12-15(23-20)7-5-8-17(12)27-19(16)25/h3-4,6,9-11,22H,2,5,7-8,20H2,1H3/b13-11+,23-15+ |
| InChIKey | KHVVUTCIJMPQCN-BZDIYGFGSA-N |
| XLogP | 2.05 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|