C21H19NO6 — CID 135462329
ethyl (Z)-2-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135462329) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is ethyl (Z)-2-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135462329 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | ethyl (Z)-2-[(2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc2c(oc1=O)CCCC2=O)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C21H19NO6/c1-2-27-20(25)15(19(24)13-7-4-3-5-8-13)12-22-16-11-14-17(23)9-6-10-18(14)28-21(16)26/h3-5,7-8,11-12,24H,2,6,9-10H2,1H3/b19-15-,22-12+ |
| InChIKey | LOZBBVYGVGDBDI-YQNFHLPDSA-N |
| XLogP | 3.39 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|