C13H14N2O4 — CID 173301487
ethyl 2-(carbamoyliminomethyl)-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 173301487) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is ethyl 2-(carbamoyliminomethyl)-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl 2-(carbamoyliminomethyl)-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 173301487 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 2-(carbamoyliminomethyl)-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(C=NC(N)=O)=C(O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O4/c1-2-19-12(17)10(8-15-13(14)18)11(16)9-6-4-3-5-7-9/h3-8,16H,2H2,1H3,(H2,14,18) |
| InChIKey | UNIOLHBGWZQWCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|