C21H22ClN5O5 — CID 135837174
ethyl (E)-2-[[(Z)-1-[2-(6-chloro-4-methylpyridazin-3-yl)hydrazinyl]-3-methoxy-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135837174) has the molecular formula C21H22ClN5O5 and a molecular weight of 459.89 g/mol. Its IUPAC name is ethyl (E)-2-[[(Z)-1-[2-(6-chloro-4-methylpyridazin-3-yl)hydrazinyl]-3-methoxy-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-[[(Z)-1-[2-(6-chloro-4-methylpyridazin-3-yl)hydrazinyl]-3-methoxy-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135837174 |
| Molecular Formula | C21H22ClN5O5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl (E)-2-[[(Z)-1-[2-(6-chloro-4-methylpyridazin-3-yl)hydrazinyl]-3-methoxy-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C(=C\NNc1nnc(Cl)cc1C)C(=O)OC)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C21H22ClN5O5/c1-4-32-20(29)15(18(28)14-8-6-5-7-9-14)11-23-16(21(30)31-3)12-24-26-19-13(2)10-17(22)25-27-19/h5-12,24,28H,4H2,1-3H3,(H,26,27)/b16-12-,18-15+,23-11+ |
| InChIKey | HKRUBUAXPSAJIF-OPYBBWRRSA-N |
| XLogP | 2.97 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|