C20H21N3O6 — CID 135480119
ethyl (E)-2-[[(Z)-3-ethoxy-1-(1,2-oxazol-3-ylamino)-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 135480119) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is ethyl (E)-2-[[(Z)-3-ethoxy-1-(1,2-oxazol-3-ylamino)-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (E)-2-[[(Z)-3-ethoxy-1-(1,2-oxazol-3-ylamino)-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135480119 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | ethyl (E)-2-[[(Z)-3-ethoxy-1-(1,2-oxazol-3-ylamino)-3-oxoprop-1-en-2-yl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(=C/Nc1ccon1)/N=C/C(C(=O)OCC)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O6/c1-3-27-19(25)15(18(24)14-8-6-5-7-9-14)12-21-16(20(26)28-4-2)13-22-17-10-11-29-23-17/h5-13,24H,3-4H2,1-2H3,(H,22,23)/b16-13-,18-15+,21-12+ |
| InChIKey | XNAQAIAQHNFMGP-QLOGSPLRSA-N |
| XLogP | 3.09 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|