C22H21NO6 — CID 135518653
ethyl (Z)-3-hydroxy-2-[(7-methyl-2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-phenylprop-2-enoate (PubChem CID 135518653) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-[(7-methyl-2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-[(7-methyl-2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135518653 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-[(7-methyl-2,5-dioxo-7,8-dihydro-6H-chromen-3-yl)iminomethyl]-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc2c(oc1=O)CC(C)CC2=O)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C22H21NO6/c1-3-28-21(26)16(20(25)14-7-5-4-6-8-14)12-23-17-11-15-18(24)9-13(2)10-19(15)29-22(17)27/h4-8,11-13,25H,3,9-10H2,1-2H3/b20-16-,23-12+ |
| InChIKey | UZPFHHUWHLKJPB-UNZOEUJESA-N |
| XLogP | 3.64 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|