C10H7F2NO2 — CID 84678155
1-[5-(difluoromethyl)-1,3-benzoxazol-2-yl]ethanone (PubChem CID 84678155) has the molecular formula C10H7F2NO2 and a molecular weight of 211.17 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-1,3-benzoxazol-2-yl]ethanone.
| Compound Name | 1-[5-(difluoromethyl)-1,3-benzoxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 84678155 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-[5-(difluoromethyl)-1,3-benzoxazol-2-yl]ethanone |
| SMILES | CC(=O)c1nc2cc(C(F)F)ccc2o1 |
| InChI | InChI=1S/C10H7F2NO2/c1-5(14)10-13-7-4-6(9(11)12)2-3-8(7)15-10/h2-4,9H,1H3 |
| InChIKey | IWCQJYPWRYKIJL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |