C9H6N2O4 — CID 131328273
1-(2-nitro-1,3-benzoxazol-5-yl)ethanone (PubChem CID 131328273) has the molecular formula C9H6N2O4 and a molecular weight of 206.16 g/mol. Its IUPAC name is 1-(2-nitro-1,3-benzoxazol-5-yl)ethanone.
| Compound Name | 1-(2-nitro-1,3-benzoxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 131328273 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1-(2-nitro-1,3-benzoxazol-5-yl)ethanone |
| SMILES | CC(=O)c1ccc2oc([N+](=O)[O-])nc2c1 |
| InChI | InChI=1S/C9H6N2O4/c1-5(12)6-2-3-8-7(4-6)10-9(15-8)11(13)14/h2-4H,1H3 |
| InChIKey | YFGBZFAKJHCQNX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|