C19H20BrN3O — CID 112719850
2-(4-bromophenyl)-5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazole (PubChem CID 112719850) has the molecular formula C19H20BrN3O and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazole.
| Compound Name | 2-(4-bromophenyl)-5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 112719850 |
| Molecular Formula | C19H20BrN3O |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-(4-bromophenyl)-5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazole |
| SMILES | Brc1ccc(-c2nc3cc(CN4CCCNCC4)ccc3o2)cc1 |
| InChI | InChI=1S/C19H20BrN3O/c20-16-5-3-15(4-6-16)19-22-17-12-14(2-7-18(17)24-19)13-23-10-1-8-21-9-11-23/h2-7,12,21H,1,8-11,13H2 |
| InChIKey | JWJQLVNJSIZQGS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |