C19H22N4O — CID 83949534
4-[5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazol-2-yl]aniline (PubChem CID 83949534) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazol-2-yl]aniline.
| Compound Name | 4-[5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazol-2-yl]aniline |
|---|---|
| PubChem CID | 83949534 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-[5-(1,4-diazepan-1-ylmethyl)-1,3-benzoxazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3cc(CN4CCCNCC4)ccc3o2)cc1 |
| InChI | InChI=1S/C19H22N4O/c20-16-5-3-15(4-6-16)19-22-17-12-14(2-7-18(17)24-19)13-23-10-1-8-21-9-11-23/h2-7,12,21H,1,8-11,13,20H2 |
| InChIKey | XRAPKPTUMHKNHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|