C17H13N3O2S — CID 10543905
2-amino-5-[(2-phenyl-1,3-benzoxazol-5-yl)methyl]-1,3-thiazol-4-one (PubChem CID 10543905) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-amino-5-[(2-phenyl-1,3-benzoxazol-5-yl)methyl]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(2-phenyl-1,3-benzoxazol-5-yl)methyl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 10543905 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-amino-5-[(2-phenyl-1,3-benzoxazol-5-yl)methyl]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(Cc2ccc3oc(-c4ccccc4)nc3c2)S1 |
| InChI | InChI=1S/C17H13N3O2S/c18-17-20-15(21)14(23-17)9-10-6-7-13-12(8-10)19-16(22-13)11-4-2-1-3-5-11/h1-8,14H,9H2,(H2,18,20,21) |
| InChIKey | HGROXTBREZCGJJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |