C22H17N3O5 — CID 18982981
4-[[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-oxazolidine-2,5-dione (PubChem CID 18982981) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is 4-[[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 18982981 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[[2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-1,3-benzoxazol-5-yl]methyl]-1,3-oxazolidine-2,5-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1Cc1nc2cc(CC3NC(=O)OC3=O)ccc2o1 |
| InChI | InChI=1S/C22H17N3O5/c1-12-15(24-20(28-12)14-5-3-2-4-6-14)11-19-23-16-9-13(7-8-18(16)29-19)10-17-21(26)30-22(27)25-17/h2-9,17H,10-11H2,1H3,(H,25,27) |
| InChIKey | LFTGQUBZGNWOHE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|