C26H28N2O6 — CID 22622692
4-[5-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione (PubChem CID 22622692) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[5-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione.
| Compound Name | 4-[5-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 22622692 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[5-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]pentyl]-1,3-oxazolidine-2,5-dione |
| SMILES | COc1cc(CCCCCC2NC(=O)OC2=O)ccc1OCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C26H28N2O6/c1-17-21(27-24(33-17)19-10-6-4-7-11-19)16-32-22-14-13-18(15-23(22)31-2)9-5-3-8-12-20-25(29)34-26(30)28-20/h4,6-7,10-11,13-15,20H,3,5,8-9,12,16H2,1-2H3,(H,28,30) |
| InChIKey | HXBBCVPUYDVHTA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|