C25H31NO4 — CID 67598182
1-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]heptan-1-ol (PubChem CID 67598182) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]heptan-1-ol.
| Compound Name | 1-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]heptan-1-ol |
|---|---|
| PubChem CID | 67598182 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[3-methoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]heptan-1-ol |
| SMILES | CCCCCCC(O)c1ccc(OCc2nc(-c3ccccc3)oc2C)c(OC)c1 |
| InChI | InChI=1S/C25H31NO4/c1-4-5-6-10-13-22(27)20-14-15-23(24(16-20)28-3)29-17-21-18(2)30-25(26-21)19-11-8-7-9-12-19/h7-9,11-12,14-16,22,27H,4-6,10,13,17H2,1-3H3 |
| InChIKey | LWBNKZPLEDMXLT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|